About sodium;4-diazenylbenzenesulfonic acid;hydride
sodium;4-diazenylbenzenesulfonic acid;hydride (PubChem CID 174985834) has the molecular formula C6H7N2NaO3S
and a molecular weight of 210.19 g/mol. Its IUPAC name is sodium;4-diazenylbenzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;4-diazenylbenzenesulfonic acid;hydride |
| PubChem CID | 174985834 |
| Molecular Formula | C6H7N2NaO3S |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | sodium;4-diazenylbenzenesulfonic acid;hydride |
| SMILES | [H-].[H]/N=N/c1ccc(S(=O)(=O)O)cc1.[Na+] |
| InChI | InChI=1S/C6H6N2O3S.Na.H/c7-8-5-1-3-6(4-2-5)12(9,10)11;;/h1-4,7H,(H,9,10,11);;/q;+1;-1/b8-7+;; |
| InChIKey | LKQDDPQNYNMFBS-MIIBGCIDSA-N |
| XLogP | -1.29 |
| TPSA | 90.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-diazenylbenzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-diazenylbenzenesulfonic acid;hydride?
The IUPAC name of sodium;4-diazenylbenzenesulfonic acid;hydride (CID 174985834) is sodium;4-diazenylbenzenesulfonic acid;hydride.
What is the SMILES notation for sodium;4-diazenylbenzenesulfonic acid;hydride?
The canonical SMILES for sodium;4-diazenylbenzenesulfonic acid;hydride is [H-].[H]/N=N/c1ccc(S(=O)(=O)O)cc1.[Na+].
What is the InChIKey of sodium;4-diazenylbenzenesulfonic acid;hydride?
The InChIKey is LKQDDPQNYNMFBS-MIIBGCIDSA-N. The full InChI is InChI=1S/C6H6N2O3S.Na.H/c7-8-5-1-3-6(4-2-5)12(9,10)11;;/h1-4,7H,(H,9,10,11);;/q;+1;-1/b8-7+;;.
What are the key properties of sodium;4-diazenylbenzenesulfonic acid;hydride?
sodium;4-diazenylbenzenesulfonic acid;hydride has a molecular weight of 210.19 g/mol, XLogP of -1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-diazenylbenzenesulfonic acid;hydride is sourced from PubChem (CID 174985834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).