C12H12Cl2O6S2 — CID 88734804
4-(4-sulfophenyl)benzenesulfonic acid;dihydrochloride (PubChem CID 88734804) has the molecular formula C12H12Cl2O6S2 and a molecular weight of 387.26 g/mol. Its IUPAC name is 4-(4-sulfophenyl)benzenesulfonic acid;dihydrochloride.
| Compound Name | 4-(4-sulfophenyl)benzenesulfonic acid;dihydrochloride |
|---|---|
| PubChem CID | 88734804 |
| Molecular Formula | C12H12Cl2O6S2 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 4-(4-sulfophenyl)benzenesulfonic acid;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(O)c1ccc(-c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C12H10O6S2.2ClH/c13-19(14,15)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(16,17)18;;/h1-8H,(H,13,14,15)(H,16,17,18);2*1H |
| InChIKey | DZKGZWGYCYPAAG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|