C30H24N2O12S4 — CID 123260727
4-[2,5-diamino-3,4,6-tris(4-sulfophenyl)phenyl]benzenesulfonic acid (PubChem CID 123260727) has the molecular formula C30H24N2O12S4 and a molecular weight of 732.79 g/mol. Its IUPAC name is 4-[2,5-diamino-3,4,6-tris(4-sulfophenyl)phenyl]benzenesulfonic acid.
| Compound Name | 4-[2,5-diamino-3,4,6-tris(4-sulfophenyl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123260727 |
| Molecular Formula | C30H24N2O12S4 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.02 |
| IUPAC Name | 4-[2,5-diamino-3,4,6-tris(4-sulfophenyl)phenyl]benzenesulfonic acid |
| SMILES | Nc1c(-c2ccc(S(=O)(=O)O)cc2)c(-c2ccc(S(=O)(=O)O)cc2)c(N)c(-c2ccc(S(=O)(=O)O)cc2)c1-c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C30H24N2O12S4/c31-29-25(17-1-9-21(10-2-17)45(33,34)35)26(18-3-11-22(12-4-18)46(36,37)38)30(32)28(20-7-15-24(16-8-20)48(42,43)44)27(29)19-5-13-23(14-6-19)47(39,40)41/h1-16H,31-32H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44) |
| InChIKey | FLDSGBSBFFFSIA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 269.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|