About 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium
4-aminobenzenesulfonic acid;hydroxy(oxo)titanium (PubChem CID 88812544) has the molecular formula C6H8NO5STi
and a molecular weight of 254.07 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium |
| PubChem CID | 88812544 |
| Molecular Formula | C6H8NO5STi |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1.O=[Ti]O |
| InChI | InChI=1S/C6H7NO3S.H2O.O.Ti/c7-5-1-3-6(4-2-5)11(8,9)10;;;/h1-4H,7H2,(H,8,9,10);1H2;;/q;;;+1/p-1 |
| InChIKey | WOGAZDBGSQXIQW-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium?
The IUPAC name of 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium (CID 88812544) is 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium.
What is the SMILES notation for 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium?
The canonical SMILES for 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium is Nc1ccc(S(=O)(=O)O)cc1.O=[Ti]O.
What is the InChIKey of 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium?
The InChIKey is WOGAZDBGSQXIQW-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S.H2O.O.Ti/c7-5-1-3-6(4-2-5)11(8,9)10;;;/h1-4H,7H2,(H,8,9,10);1H2;;/q;;;+1/p-1.
What are the key properties of 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium?
4-aminobenzenesulfonic acid;hydroxy(oxo)titanium has a molecular weight of 254.07 g/mol, XLogP of -0.16, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonic acid;hydroxy(oxo)titanium is sourced from PubChem (CID 88812544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).