C18H19N5O3S — CID 152936105
4-[2,4-diamino-5-(4-aminoanilino)anilino]benzenesulfonic acid (PubChem CID 152936105) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[2,4-diamino-5-(4-aminoanilino)anilino]benzenesulfonic acid.
| Compound Name | 4-[2,4-diamino-5-(4-aminoanilino)anilino]benzenesulfonic acid |
|---|---|
| PubChem CID | 152936105 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[2,4-diamino-5-(4-aminoanilino)anilino]benzenesulfonic acid |
| SMILES | Nc1ccc(Nc2cc(Nc3ccc(S(=O)(=O)O)cc3)c(N)cc2N)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c19-11-1-3-12(4-2-11)22-17-10-18(16(21)9-15(17)20)23-13-5-7-14(8-6-13)27(24,25)26/h1-10,22-23H,19-21H2,(H,24,25,26) |
| InChIKey | ULWSSGZYQHGQQW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 156.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|