C12H14N4O6S2 — CID 2749936
3-amino-4-[2-(2-amino-4-sulfophenyl)hydrazinyl]benzenesulfonic acid (PubChem CID 2749936) has the molecular formula C12H14N4O6S2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-amino-4-[2-(2-amino-4-sulfophenyl)hydrazinyl]benzenesulfonic acid.
| Compound Name | 3-amino-4-[2-(2-amino-4-sulfophenyl)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 2749936 |
| Molecular Formula | C12H14N4O6S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 3-amino-4-[2-(2-amino-4-sulfophenyl)hydrazinyl]benzenesulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)ccc1NNc1ccc(S(=O)(=O)O)cc1N |
| InChI | InChI=1S/C12H14N4O6S2/c13-9-5-7(23(17,18)19)1-3-11(9)15-16-12-4-2-8(6-10(12)14)24(20,21)22/h1-6,15-16H,13-14H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | RUYFAOCCPNIMPZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|