C9H10Br2N2O4S — CID 18546708
3-amino-4-(2,3-dibromopropanoylamino)benzenesulfonic acid (PubChem CID 18546708) has the molecular formula C9H10Br2N2O4S and a molecular weight of 402.06 g/mol. Its IUPAC name is 3-amino-4-(2,3-dibromopropanoylamino)benzenesulfonic acid.
| Compound Name | 3-amino-4-(2,3-dibromopropanoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 18546708 |
| Molecular Formula | C9H10Br2N2O4S |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.87 |
| IUPAC Name | 3-amino-4-(2,3-dibromopropanoylamino)benzenesulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)ccc1NC(=O)C(Br)CBr |
| InChI | InChI=1S/C9H10Br2N2O4S/c10-4-6(11)9(14)13-8-2-1-5(3-7(8)12)18(15,16)17/h1-3,6H,4,12H2,(H,13,14)(H,15,16,17) |
| InChIKey | DGDLFWUTAIYLCU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|