C16H19N3O3S — CID 143181855
4-[2-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)hydrazinyl]benzenesulfonic acid (PubChem CID 143181855) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-[2-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[2-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143181855 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[2-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)hydrazinyl]benzenesulfonic acid |
| SMILES | Nc1ccc(NNc2ccc(S(=O)(=O)O)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C16H19N3O3S/c17-15-9-10-16(14-4-2-1-3-13(14)15)19-18-11-5-7-12(8-6-11)23(20,21)22/h5-10,18-19H,1-4,17H2,(H,20,21,22) |
| InChIKey | GVQGCCNXPHMHNB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|