About (4-sulfoanilino)azanium chloride
(4-sulfoanilino)azanium chloride (PubChem CID 11172143) has the molecular formula C6H9ClN2O3S
and a molecular weight of 224.67 g/mol. Its IUPAC name is (4-sulfoanilino)azanium chloride.
Molecular Properties
| Compound Name | (4-sulfoanilino)azanium chloride |
| PubChem CID | 11172143 |
| Molecular Formula | C6H9ClN2O3S |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (4-sulfoanilino)azanium chloride |
| SMILES | [Cl-].[NH3+]Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C6H8N2O3S.ClH/c7-8-5-1-3-6(4-2-5)12(9,10)11;/h1-4,8H,7H2,(H,9,10,11);1H |
| InChIKey | XIVNIDRSRRIUHQ-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfoanilino)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfoanilino)azanium chloride?
The IUPAC name of (4-sulfoanilino)azanium chloride (CID 11172143) is (4-sulfoanilino)azanium chloride.
What is the SMILES notation for (4-sulfoanilino)azanium chloride?
The canonical SMILES for (4-sulfoanilino)azanium chloride is [Cl-].[NH3+]Nc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of (4-sulfoanilino)azanium chloride?
The InChIKey is XIVNIDRSRRIUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S.ClH/c7-8-5-1-3-6(4-2-5)12(9,10)11;/h1-4,8H,7H2,(H,9,10,11);1H.
What are the key properties of (4-sulfoanilino)azanium chloride?
(4-sulfoanilino)azanium chloride has a molecular weight of 224.67 g/mol, XLogP of -3.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfoanilino)azanium chloride is sourced from PubChem (CID 11172143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).