C8H10N2O4S — CID 58709255
4-(methylcarbamoylamino)benzenesulfonic acid (PubChem CID 58709255) has the molecular formula C8H10N2O4S and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-(methylcarbamoylamino)benzenesulfonic acid.
| Compound Name | 4-(methylcarbamoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 58709255 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-(methylcarbamoylamino)benzenesulfonic acid |
| SMILES | CNC(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H10N2O4S/c1-9-8(11)10-6-2-4-7(5-3-6)15(12,13)14/h2-5H,1H3,(H2,9,10,11)(H,12,13,14) |
| InChIKey | MBUYMBPDUDMFDH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|