C20H18N2O4S — CID 108867379
4-(benzhydrylcarbamoylamino)benzenesulfonic acid (PubChem CID 108867379) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-(benzhydrylcarbamoylamino)benzenesulfonic acid.
| Compound Name | 4-(benzhydrylcarbamoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 108867379 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-(benzhydrylcarbamoylamino)benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)cc1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S/c23-20(21-17-11-13-18(14-12-17)27(24,25)26)22-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19H,(H2,21,22,23)(H,24,25,26) |
| InChIKey | JHPMZIWSOMUMOQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|