C20H18N2O4 — CID 108871724
1-benzhydryl-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871724) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-benzhydryl-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-benzhydryl-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871724 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-benzhydryl-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | O=C(Nc1cc(O)c(O)c(O)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4/c23-16-11-15(12-17(24)19(16)25)21-20(26)22-18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,18,23-25H,(H2,21,22,26) |
| InChIKey | NMRPWFJDAQVNLV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|