C27H24N4O4S — CID 154259297
1-benzhydryl-3-[3-(phenylcarbamoylamino)phenyl]sulfonylurea (PubChem CID 154259297) has the molecular formula C27H24N4O4S and a molecular weight of 500.58 g/mol. Its IUPAC name is 1-benzhydryl-3-[3-(phenylcarbamoylamino)phenyl]sulfonylurea.
| Compound Name | 1-benzhydryl-3-[3-(phenylcarbamoylamino)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 154259297 |
| Molecular Formula | C27H24N4O4S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 1-benzhydryl-3-[3-(phenylcarbamoylamino)phenyl]sulfonylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(S(=O)(=O)NC(=O)NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O4S/c32-26(28-22-15-8-3-9-16-22)29-23-17-10-18-24(19-23)36(34,35)31-27(33)30-25(20-11-4-1-5-12-20)21-13-6-2-7-14-21/h1-19,25H,(H2,28,29,32)(H2,30,31,33) |
| InChIKey | ZBUIJTVSZPNENJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |