C18H22N4O3S2 — CID 139878364
1-[3-(tert-butylcarbamothioylamino)phenyl]sulfonyl-3-phenylurea (PubChem CID 139878364) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[3-(tert-butylcarbamothioylamino)phenyl]sulfonyl-3-phenylurea.
| Compound Name | 1-[3-(tert-butylcarbamothioylamino)phenyl]sulfonyl-3-phenylurea |
|---|---|
| PubChem CID | 139878364 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[3-(tert-butylcarbamothioylamino)phenyl]sulfonyl-3-phenylurea |
| SMILES | CC(C)(C)NC(=S)Nc1cccc(S(=O)(=O)NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H22N4O3S2/c1-18(2,3)21-17(26)20-14-10-7-11-15(12-14)27(24,25)22-16(23)19-13-8-5-4-6-9-13/h4-12H,1-3H3,(H2,19,22,23)(H2,20,21,26) |
| InChIKey | DYVCKPUZXHFGSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|