C26H22N4O2S3 — CID 4126128
1-phenyl-3-[3-[3-(phenylcarbamothioylamino)phenyl]sulfonylphenyl]thiourea (PubChem CID 4126128) has the molecular formula C26H22N4O2S3 and a molecular weight of 518.69 g/mol. Its IUPAC name is 1-phenyl-3-[3-[3-(phenylcarbamothioylamino)phenyl]sulfonylphenyl]thiourea.
| Compound Name | 1-phenyl-3-[3-[3-(phenylcarbamothioylamino)phenyl]sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 4126128 |
| Molecular Formula | C26H22N4O2S3 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 1-phenyl-3-[3-[3-(phenylcarbamothioylamino)phenyl]sulfonylphenyl]thiourea |
| SMILES | O=S(=O)(c1cccc(NC(=S)Nc2ccccc2)c1)c1cccc(NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C26H22N4O2S3/c31-35(32,23-15-7-13-21(17-23)29-25(33)27-19-9-3-1-4-10-19)24-16-8-14-22(18-24)30-26(34)28-20-11-5-2-6-12-20/h1-18H,(H2,27,29,33)(H2,28,30,34) |
| InChIKey | NAMJLVYGBVOLEY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|