C19H25N3O2S2 — CID 46800335
1-(4-tert-butylphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 46800335) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 46800335 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-19(2,3)14-9-11-15(12-10-14)20-18(25)21-16-7-6-8-17(13-16)26(23,24)22(4)5/h6-13H,1-5H3,(H2,20,21,25) |
| InChIKey | XFYMXLYEHKGYGF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|