C24H26N4O4S2 — CID 42993002
4-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 42993002) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 4-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 4-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 42993002 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 4-[[3-(dimethylsulfamoyl)phenyl]carbamothioylamino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=S)Nc3cccc(S(=O)(=O)N(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-4-32-21-14-12-18(13-15-21)25-23(29)17-8-10-19(11-9-17)26-24(33)27-20-6-5-7-22(16-20)34(30,31)28(2)3/h5-16H,4H2,1-3H3,(H,25,29)(H2,26,27,33) |
| InChIKey | SHBWIAFPYHYPGE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|