C22H21N3O5S — CID 154762615
3-ethoxy-N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]benzamide (PubChem CID 154762615) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-ethoxy-N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 3-ethoxy-N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 154762615 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-ethoxy-N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]benzamide |
| SMILES | CCOc1cccc(C(=O)Nc2ccc(C(=O)Nc3cccc(S(N)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-2-30-19-7-3-5-16(13-19)22(27)24-17-11-9-15(10-12-17)21(26)25-18-6-4-8-20(14-18)31(23,28)29/h3-14H,2H2,1H3,(H,24,27)(H,25,26)(H2,23,28,29) |
| InChIKey | JDYWPGMDOAJTEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |