C18H21N3O5S — CID 9068676
tert-butyl N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 9068676) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9068676 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | tert-butyl N-[4-[(3-sulfamoylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)Nc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-18(2,3)26-17(23)21-13-9-7-12(8-10-13)16(22)20-14-5-4-6-15(11-14)27(19,24)25/h4-11H,1-3H3,(H,20,22)(H,21,23)(H2,19,24,25) |
| InChIKey | LELBGOYAYGXGQX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |