C19H20N2O4 — CID 134492042
tert-butyl N-[3-[(4-formylbenzoyl)amino]phenyl]carbamate (PubChem CID 134492042) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-formylbenzoyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-formylbenzoyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 134492042 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | tert-butyl N-[3-[(4-formylbenzoyl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC(=O)c2ccc(C=O)cc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-19(2,3)25-18(24)21-16-6-4-5-15(11-16)20-17(23)14-9-7-13(12-22)8-10-14/h4-12H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | YHFYVNNLHUFDFF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|