C16H16N4O2S2 — CID 8614863
1-(3-cyanophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea (PubChem CID 8614863) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3-cyanophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 8614863 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[3-(dimethylsulfamoyl)phenyl]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C16H16N4O2S2/c1-20(2)24(21,22)15-8-4-7-14(10-15)19-16(23)18-13-6-3-5-12(9-13)11-17/h3-10H,1-2H3,(H2,18,19,23) |
| InChIKey | OTCXKZMXMJRYMY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|