C16H17N5O2S2 — CID 4235162
1-[3-(dimethylsulfamoyl)phenyl]-3-(1H-indazol-6-yl)thiourea (PubChem CID 4235162) has the molecular formula C16H17N5O2S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(1H-indazol-6-yl)thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(1H-indazol-6-yl)thiourea |
|---|---|
| PubChem CID | 4235162 |
| Molecular Formula | C16H17N5O2S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(1H-indazol-6-yl)thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C16H17N5O2S2/c1-21(2)25(22,23)14-5-3-4-12(8-14)18-16(24)19-13-7-6-11-10-17-20-15(11)9-13/h3-10H,1-2H3,(H,17,20)(H2,18,19,24) |
| InChIKey | FZQZMAPQGYNQTN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|