C17H17N5O2 — CID 108529059
N-[3-(dimethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide (PubChem CID 108529059) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide.
| Compound Name | N-[3-(dimethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide |
|---|---|
| PubChem CID | 108529059 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]-N'-(1H-indazol-6-yl)oxamide |
| SMILES | CN(C)c1cccc(NC(=O)C(=O)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C17H17N5O2/c1-22(2)14-5-3-4-12(8-14)19-16(23)17(24)20-13-7-6-11-10-18-21-15(11)9-13/h3-10H,1-2H3,(H,18,21)(H,19,23)(H,20,24) |
| InChIKey | GBTQBKNWAQSHFT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|