C14H18N4O2 — CID 108528519
N'-butyl-N-(1H-indazol-6-yl)-N'-methyloxamide (PubChem CID 108528519) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N'-butyl-N-(1H-indazol-6-yl)-N'-methyloxamide.
| Compound Name | N'-butyl-N-(1H-indazol-6-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108528519 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N'-butyl-N-(1H-indazol-6-yl)-N'-methyloxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C14H18N4O2/c1-3-4-7-18(2)14(20)13(19)16-11-6-5-10-9-15-17-12(10)8-11/h5-6,8-9H,3-4,7H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | JIWQTVBWWLOZTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|