C14H17F3N2O2 — CID 108528580
N'-butyl-N'-methyl-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 108528580) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N'-butyl-N'-methyl-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-butyl-N'-methyl-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108528580 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N'-butyl-N'-methyl-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-3-4-9-19(2)13(21)12(20)18-11-7-5-10(6-8-11)14(15,16)17/h5-8H,3-4,9H2,1-2H3,(H,18,20) |
| InChIKey | PGBCKQPHLGIDTP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|