C18H21F3N4O — CID 109333587
2-[butyl(methyl)amino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109333587) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-[butyl(methyl)amino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109333587 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-[butyl(methyl)amino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | CCCCN(C)c1nc(C)cc(C(=O)Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H21F3N4O/c1-4-5-10-25(3)17-22-12(2)11-15(24-17)16(26)23-14-8-6-13(7-9-14)18(19,20)21/h6-9,11H,4-5,10H2,1-3H3,(H,23,26) |
| InChIKey | GNGZGRXBRBYZMK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |