C17H17F3N4O — CID 109321669
6-methyl-2-pyrrolidin-1-yl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109321669) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 6-methyl-2-pyrrolidin-1-yl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-methyl-2-pyrrolidin-1-yl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109321669 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 6-methyl-2-pyrrolidin-1-yl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(F)(F)F)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C17H17F3N4O/c1-11-10-14(23-16(21-11)24-8-2-3-9-24)15(25)22-13-6-4-12(5-7-13)17(18,19)20/h4-7,10H,2-3,8-9H2,1H3,(H,22,25) |
| InChIKey | VMMUOXRYNCLOIF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |