C23H24N4O2 — CID 109322398
6-methyl-N-(4-phenoxyphenyl)-2-piperidin-1-ylpyrimidine-4-carboxamide (PubChem CID 109322398) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-methyl-N-(4-phenoxyphenyl)-2-piperidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 6-methyl-N-(4-phenoxyphenyl)-2-piperidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109322398 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 6-methyl-N-(4-phenoxyphenyl)-2-piperidin-1-ylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Oc3ccccc3)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H24N4O2/c1-17-16-21(26-23(24-17)27-14-6-3-7-15-27)22(28)25-18-10-12-20(13-11-18)29-19-8-4-2-5-9-19/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3,(H,25,28) |
| InChIKey | UTQDNGLQRGUEPB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |