C16H17FN4O — CID 109321642
N-(4-fluorophenyl)-6-methyl-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 109321642) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-methyl-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-methyl-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109321642 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(4-fluorophenyl)-6-methyl-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C16H17FN4O/c1-11-10-14(20-16(18-11)21-8-2-3-9-21)15(22)19-13-6-4-12(17)5-7-13/h4-7,10H,2-3,8-9H2,1H3,(H,19,22) |
| InChIKey | VOFGKKDZHRCFBR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |