C13H12FN3O — CID 110858651
N-(4-fluorophenyl)-2,6-dimethylpyrimidine-4-carboxamide (PubChem CID 110858651) has the molecular formula C13H12FN3O and a molecular weight of 245.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110858651 |
| Molecular Formula | C13H12FN3O |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(4-fluorophenyl)-2,6-dimethylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)cc2)nc(C)n1 |
| InChI | InChI=1S/C13H12FN3O/c1-8-7-12(16-9(2)15-8)13(18)17-11-5-3-10(14)4-6-11/h3-7H,1-2H3,(H,17,18) |
| InChIKey | GGNHPMRFVSCJFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |