C18H22F3N5O — CID 109325516
2-[3-(dimethylamino)propylamino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109325516) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-[3-(dimethylamino)propylamino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325516 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-6-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(F)(F)F)cc2)nc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C18H22F3N5O/c1-12-11-15(25-17(23-12)22-9-4-10-26(2)3)16(27)24-14-7-5-13(6-8-14)18(19,20)21/h5-8,11H,4,9-10H2,1-3H3,(H,24,27)(H,22,23,25) |
| InChIKey | WHRMCLFNDUZUMU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|