C16H30N6O — CID 109325406
N-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylamino]-6-methylpyrimidine-4-carboxamide (PubChem CID 109325406) has the molecular formula C16H30N6O and a molecular weight of 322.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylamino]-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylamino]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325406 |
| Molecular Formula | C16H30N6O |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylamino]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN(C)C)nc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C16H30N6O/c1-13-12-14(15(23)17-8-6-10-21(2)3)20-16(19-13)18-9-7-11-22(4)5/h12H,6-11H2,1-5H3,(H,17,23)(H,18,19,20) |
| InChIKey | MMYKTHJHBMMCAT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|