C19H28N6O — CID 109325671
2-[4-(dimethylamino)anilino]-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-4-carboxamide (PubChem CID 109325671) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[4-(dimethylamino)anilino]-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-[4-(dimethylamino)anilino]-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325671 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 2-[4-(dimethylamino)anilino]-N-[3-(dimethylamino)propyl]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN(C)C)nc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C19H28N6O/c1-14-13-17(18(26)20-11-6-12-24(2)3)23-19(21-14)22-15-7-9-16(10-8-15)25(4)5/h7-10,13H,6,11-12H2,1-5H3,(H,20,26)(H,21,22,23) |
| InChIKey | QJXZHMBNVLQAOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|