C16H18Cl2N4O — CID 109320778
N-butyl-2-(3,4-dichloroanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109320778) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is N-butyl-2-(3,4-dichloroanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-2-(3,4-dichloroanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320778 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-butyl-2-(3,4-dichloroanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(C)nc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-3-4-7-19-15(23)14-8-10(2)20-16(22-14)21-11-5-6-12(17)13(18)9-11/h5-6,8-9H,3-4,7H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | LYPTVGOLJSJRIK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|