C15H14Cl2N4O — CID 109320398
2-(3,4-dichloroanilino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide (PubChem CID 109320398) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide.
| Compound Name | 2-(3,4-dichloroanilino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320398 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-(3,4-dichloroanilino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(C)nc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H14Cl2N4O/c1-3-6-18-14(22)13-7-9(2)19-15(21-13)20-10-4-5-11(16)12(17)8-10/h3-5,7-8H,1,6H2,2H3,(H,18,22)(H,19,20,21) |
| InChIKey | NEVJPYRGBUUMCN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|