C17H18N4O3 — CID 109320388
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide (PubChem CID 109320388) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320388 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-methyl-N-prop-2-enylpyrimidine-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(C)nc(Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C17H18N4O3/c1-3-6-18-16(22)13-9-11(2)19-17(21-13)20-12-4-5-14-15(10-12)24-8-7-23-14/h3-5,9-10H,1,6-8H2,2H3,(H,18,22)(H,19,20,21) |
| InChIKey | UEWDUDJISDPVCP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|