C16H13Cl2N3O2 — CID 109094177
6-N-(3,4-dichlorophenyl)-2-N-prop-2-enylpyridine-2,6-dicarboxamide (PubChem CID 109094177) has the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 6-N-(3,4-dichlorophenyl)-2-N-prop-2-enylpyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3,4-dichlorophenyl)-2-N-prop-2-enylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109094177 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 6-N-(3,4-dichlorophenyl)-2-N-prop-2-enylpyridine-2,6-dicarboxamide |
| SMILES | C=CCNC(=O)c1cccc(C(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H13Cl2N3O2/c1-2-8-19-15(22)13-4-3-5-14(21-13)16(23)20-10-6-7-11(17)12(18)9-10/h2-7,9H,1,8H2,(H,19,22)(H,20,23) |
| InChIKey | CYUDOCQVTNOXSH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|