C23H19N3O2 — CID 156600187
2-N,6-N-bis(4-ethenylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 156600187) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-N,6-N-bis(4-ethenylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-ethenylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 156600187 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-N,6-N-bis(4-ethenylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | C=Cc1ccc(NC(=O)c2cccc(C(=O)Nc3ccc(C=C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-3-16-8-12-18(13-9-16)24-22(27)20-6-5-7-21(26-20)23(28)25-19-14-10-17(4-2)11-15-19/h3-15H,1-2H2,(H,24,27)(H,25,28) |
| InChIKey | OUPMAKYUNVXKQW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |