About 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide
2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 100978561) has the molecular formula C19H15N3O2S2
and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide |
| PubChem CID | 100978561 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1cccc(S)c1)c1cccc(C(=O)Nc2cccc(S)c2)n1 |
| InChI | InChI=1S/C19H15N3O2S2/c23-18(20-12-4-1-6-14(25)10-12)16-8-3-9-17(22-16)19(24)21-13-5-2-7-15(26)11-13/h1-11,25-26H,(H,20,23)(H,21,24) |
| InChIKey | XCVPHXZUDARQJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide (CID 100978561) is 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide is O=C(Nc1cccc(S)c1)c1cccc(C(=O)Nc2cccc(S)c2)n1.
What is the InChIKey of 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide?
The InChIKey is XCVPHXZUDARQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S2/c23-18(20-12-4-1-6-14(25)10-12)16-8-3-9-17(22-16)19(24)21-13-5-2-7-15(26)11-13/h1-11,25-26H,(H,20,23)(H,21,24).
What are the key properties of 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide?
2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide has a molecular weight of 381.48 g/mol, XLogP of 4.16, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis(3-sulfanylphenyl)pyridine-2,6-dicarboxamide is sourced from PubChem (CID 100978561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).