C21H16ClN3O3 — CID 109100856
6-N-(3-acetylphenyl)-2-N-(4-chlorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 109100856) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 6-N-(3-acetylphenyl)-2-N-(4-chlorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-acetylphenyl)-2-N-(4-chlorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109100856 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 6-N-(3-acetylphenyl)-2-N-(4-chlorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cccc(C(=O)Nc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C21H16ClN3O3/c1-13(26)14-4-2-5-17(12-14)24-21(28)19-7-3-6-18(25-19)20(27)23-16-10-8-15(22)9-11-16/h2-12H,1H3,(H,23,27)(H,24,28) |
| InChIKey | FXZBDYCYWNQCPW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |