C20H23N3O3 — CID 109099391
6-N-(3-acetylphenyl)-2-N-(3-methylbutyl)pyridine-2,6-dicarboxamide (PubChem CID 109099391) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-N-(3-acetylphenyl)-2-N-(3-methylbutyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-acetylphenyl)-2-N-(3-methylbutyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099391 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-N-(3-acetylphenyl)-2-N-(3-methylbutyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cccc(C(=O)NCCC(C)C)n2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-13(2)10-11-21-19(25)17-8-5-9-18(23-17)20(26)22-16-7-4-6-15(12-16)14(3)24/h4-9,12-13H,10-11H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | PCWIEFFFNGOKAF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |