C19H15N3O6 — CID 136863629
2-N,6-N-bis(3,4-dihydroxyphenyl)pyridine-2,6-dicarboxamide (PubChem CID 136863629) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 2-N,6-N-bis(3,4-dihydroxyphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(3,4-dihydroxyphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 136863629 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-N,6-N-bis(3,4-dihydroxyphenyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc(O)c(O)c1)c1cccc(C(=O)Nc2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C19H15N3O6/c23-14-6-4-10(8-16(14)25)20-18(27)12-2-1-3-13(22-12)19(28)21-11-5-7-15(24)17(26)9-11/h1-9,23-26H,(H,20,27)(H,21,28) |
| InChIKey | YDJUXRCRRVXAEZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|