C19H13Cl4N5O2 — CID 39042283
2-N,6-N-bis(4-amino-3,5-dichlorophenyl)pyridine-2,6-dicarboxamide (PubChem CID 39042283) has the molecular formula C19H13Cl4N5O2 and a molecular weight of 485.16 g/mol. Its IUPAC name is 2-N,6-N-bis(4-amino-3,5-dichlorophenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(4-amino-3,5-dichlorophenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 39042283 |
| Molecular Formula | C19H13Cl4N5O2 |
| Molecular Weight | 485.16 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | 2-N,6-N-bis(4-amino-3,5-dichlorophenyl)pyridine-2,6-dicarboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2cccc(C(=O)Nc3cc(Cl)c(N)c(Cl)c3)n2)cc1Cl |
| InChI | InChI=1S/C19H13Cl4N5O2/c20-10-4-8(5-11(21)16(10)24)26-18(29)14-2-1-3-15(28-14)19(30)27-9-6-12(22)17(25)13(23)7-9/h1-7H,24-25H2,(H,26,29)(H,27,30) |
| InChIKey | VIPVCRKRDHQGKE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.16 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|