C14H9Cl2N3OS2 — CID 55450782
N-(4-amino-3,5-dichlorophenyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 55450782) has the molecular formula C14H9Cl2N3OS2 and a molecular weight of 370.29 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55450782 |
| Molecular Formula | C14H9Cl2N3OS2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2csc(-c3ccsc3)n2)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3OS2/c15-9-3-8(4-10(16)12(9)17)18-13(20)11-6-22-14(19-11)7-1-2-21-5-7/h1-6H,17H2,(H,18,20) |
| InChIKey | HNPLEQZTJCNSKT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|