C21H18ClN5OS2 — CID 46550186
N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 46550186) has the molecular formula C21H18ClN5OS2 and a molecular weight of 456.00 g/mol. Its IUPAC name is N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46550186 |
| Molecular Formula | C21H18ClN5OS2 |
| Molecular Weight | 456.00 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nnc3n2CCCCC3)c1)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C21H18ClN5OS2/c22-16-6-5-14(10-15(16)19-26-25-18-4-2-1-3-8-27(18)19)23-20(28)17-12-30-21(24-17)13-7-9-29-11-13/h5-7,9-12H,1-4,8H2,(H,23,28) |
| InChIKey | DMFHOVYXKQBSQR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |