C20H18ClN5O3 — CID 36938644
N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-nitrobenzamide (PubChem CID 36938644) has the molecular formula C20H18ClN5O3 and a molecular weight of 411.85 g/mol. Its IUPAC name is N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-nitrobenzamide.
| Compound Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 36938644 |
| Molecular Formula | C20H18ClN5O3 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nnc3n2CCCCC3)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18ClN5O3/c21-17-9-8-14(22-20(27)13-5-4-6-15(11-13)26(28)29)12-16(17)19-24-23-18-7-2-1-3-10-25(18)19/h4-6,8-9,11-12H,1-3,7,10H2,(H,22,27) |
| InChIKey | MJIDMLBNKPCJCC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|