C19H26Cl3N5O — CID 119842812
3-amino-N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119842812) has the molecular formula C19H26Cl3N5O and a molecular weight of 446.81 g/mol. Its IUPAC name is 3-amino-N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119842812 |
| Molecular Formula | C19H26Cl3N5O |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3-amino-N-[4-chloro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(C(=O)Nc2ccc(Cl)c(-c3nnc4n3CCCCC4)c2)C1 |
| InChI | InChI=1S/C19H24ClN5O.2ClH/c20-16-8-7-14(22-19(26)12-5-6-13(21)10-12)11-15(16)18-24-23-17-4-2-1-3-9-25(17)18;;/h7-8,11-13H,1-6,9-10,21H2,(H,22,26);2*1H |
| InChIKey | SXOYBULCUSTJRY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |