C20H26FN5O — CID 119841882
3-amino-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 119841882) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-amino-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119841882 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-amino-N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)C1 |
| InChI | InChI=1S/C20H26FN5O/c21-17-9-8-15(23-20(27)13-5-4-6-14(22)11-13)12-16(17)19-25-24-18-7-2-1-3-10-26(18)19/h8-9,12-14H,1-7,10-11,22H2,(H,23,27) |
| InChIKey | HYVNKDMSZOFLIX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |