C23H25FN4O4 — CID 36819911
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,4,5-trimethoxybenzamide (PubChem CID 36819911) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 36819911 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(F)c(-c3nnc4n3CCCCC4)c2)cc1OC |
| InChI | InChI=1S/C23H25FN4O4/c1-30-18-13-20(32-3)19(31-2)12-16(18)23(29)25-14-8-9-17(24)15(11-14)22-27-26-21-7-5-4-6-10-28(21)22/h8-9,11-13H,4-7,10H2,1-3H3,(H,25,29) |
| InChIKey | KLROMCLRLGUVBK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |