C18H19FN4O — CID 167895388
N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide (PubChem CID 167895388) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 167895388 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[4-fluoro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]bicyclo[1.1.0]butane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(-c2nnc3n2CCCCC3)c1)C12CC1C2 |
| InChI | InChI=1S/C18H19FN4O/c19-14-6-5-12(20-17(24)18-9-11(18)10-18)8-13(14)16-22-21-15-4-2-1-3-7-23(15)16/h5-6,8,11H,1-4,7,9-10H2,(H,20,24) |
| InChIKey | WHLBBQONKKZTLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |